Products 852840-61-0

CAS 852840-61-0 is the registry number for N-(2-Furylmethyl)-n-(2,2,2-trifluoroethyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2,2,2-trifluoro-N-(furan-2-ylmethyl)ethanamine (CAS 852840-61-0) is a chemical compound with the molecular formula C7H8F3NO and a molecular weight of 179.14 g/mol. IUPAC name: 2,2,2-trifluoro-N-(furan-2-ylmethyl)ethanamine. InChIKey: XTJFHYAWTNYDNF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F3NO
Molecular weight179.14 g/mol
IUPAC name2,2,2-trifluoro-N-(furan-2-ylmethyl)ethanamine
InChIKeyXTJFHYAWTNYDNF-UHFFFAOYSA-N
SMILESC1=COC(=C1)CNCC(F)(F)F

Computed by PubChem (NCBI)