Products 852846-00-5

CAS 852846-00-5 is the registry number for SA-15-P. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-[4-[2-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-oxoethoxy]phenyl]furan-2-carboxamide (CAS 852846-00-5) is a chemical compound with the molecular formula C26H24N2O4 and a molecular weight of 428.5 g/mol. IUPAC name: N-[4-[2-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-oxoethoxy]phenyl]furan-2-carboxamide. InChIKey: IYGLJCOGIQDUAE-UHFFFAOYSA-N.

Identity
Molecular formulaC26H24N2O4
Molecular weight428.5 g/mol
IUPAC nameN-[4-[2-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-oxoethoxy]phenyl]furan-2-carboxamide
InChIKeyIYGLJCOGIQDUAE-UHFFFAOYSA-N
SMILESCC1=CC(=C(N1CC2=CC=CC=C2)C)C(=O)COC3=CC=C(C=C3)NC(=O)C4=CC=CO4

Computed by PubChem (NCBI)

Synonyms: orb2664121