CAS 853-39-4 appears in our catalog under these names: Decafluorobenzophenone, 98%, Decafluorobenzophenone, Decafluorobenzophenone, >98.0%(GC), PERFLUOROBENZOPHENONE, 98%, Bis(perfluorophenyl)methanone, ≥98%(GC), ≥98%(GC). Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 1g, 25g, 200mg, 250mg.
Bis(2,3,4,5,6-pentafluorophenyl)methanone (CAS 853-39-4) is a chemical compound with the molecular formula C13F10O and a molecular weight of 362.12 g/mol. IUPAC name: bis(2,3,4,5,6-pentafluorophenyl)methanone. InChIKey: WWQLXRAKBJVNCC-UHFFFAOYSA-N.
| Molecular formula | C13F10O |
|---|---|
| Molecular weight | 362.12 g/mol |
| IUPAC name | bis(2,3,4,5,6-pentafluorophenyl)methanone |
| InChIKey | WWQLXRAKBJVNCC-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)C2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)