CAS 853073-44-6 appears in our catalog under these names: Di-tert-butylmethylphosphonium tetraphenylborate, 95%, Di-tert-butyl(methyl)phosphonium tetraphenylborate, 97%, Di–tert–butylmethylphosphonium Tetraphenylborate, Di-tert-butylmethylphosphonium Tetraphenylborate, >98.0%(T). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 1g, 250mg.
Ditert-butyl(methyl)phosphanium;tetraphenylboranuide (CAS 853073-44-6) is a chemical compound with the molecular formula C33H42BP and a molecular weight of 480.5 g/mol. IUPAC name: ditert-butyl(methyl)phosphanium;tetraphenylboranuide. InChIKey: GPICDLFVQCUBQN-UHFFFAOYSA-O.
| Molecular formula | C33H42BP |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | ditert-butyl(methyl)phosphanium;tetraphenylboranuide |
| InChIKey | GPICDLFVQCUBQN-UHFFFAOYSA-O |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.CC(C)(C)[PH+](C)C(C)(C)C |
Computed by PubChem (NCBI)