CAS 853296-96-5 is the registry number for (3-Amino-5-(trifluoromethyl)phenyl)(4-methylpiperazin-1-yl)methanone, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[3-amino-5-(trifluoromethyl)phenyl]-(4-methylpiperazin-1-yl)methanone (CAS 853296-96-5) is a chemical compound with the molecular formula C13H16F3N3O and a molecular weight of 287.28 g/mol. IUPAC name: [3-amino-5-(trifluoromethyl)phenyl]-(4-methylpiperazin-1-yl)methanone. InChIKey: VPZSTVPVDGHXIR-UHFFFAOYSA-N.
| Molecular formula | C13H16F3N3O |
|---|---|
| Molecular weight | 287.28 g/mol |
| IUPAC name | [3-amino-5-(trifluoromethyl)phenyl]-(4-methylpiperazin-1-yl)methanone |
| InChIKey | VPZSTVPVDGHXIR-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC(=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)