CAS 853299-07-7 appears in our catalog under these names: K03861, AUZ 454/ 99.3% (existing batch purity), AUZ 454, AUZ 454, 99.15%, AUZ 454, 98+%, 98+%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 5mg, 1mg, 2mg, 10mg, 50mg, 100mg, 5 mg.
1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]urea (CAS 853299-07-7) is a chemical compound with the molecular formula C24H26F3N7O2 and a molecular weight of 501.5 g/mol. IUPAC name: 1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]urea. InChIKey: PWDLXPJQFNVTNL-UHFFFAOYSA-N.
| Molecular formula | C24H26F3N7O2 |
|---|---|
| Molecular weight | 501.5 g/mol |
| IUPAC name | 1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]urea |
| InChIKey | PWDLXPJQFNVTNL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=C(C=C(C=C2)NC(=O)NC3=CC=C(C=C3)OC4=NC(=NC=C4)N)C(F)(F)F |
Computed by PubChem (NCBI)