CAS 853312-75-1 is the registry number for 3-Methyl-6-(naphthalen-2-yl)-4-(trifluoromethyl)isoxazolo[5,4-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-6-naphthalen-2-yl-4-(trifluoromethyl)-[1,2]oxazolo[5,4-b]pyridine (CAS 853312-75-1) is a chemical compound with the molecular formula C18H11F3N2O and a molecular weight of 328.3 g/mol. IUPAC name: 3-methyl-6-naphthalen-2-yl-4-(trifluoromethyl)-[1,2]oxazolo[5,4-b]pyridine. InChIKey: POIIXVAOLCUFPN-UHFFFAOYSA-N.
| Molecular formula | C18H11F3N2O |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 3-methyl-6-naphthalen-2-yl-4-(trifluoromethyl)-[1,2]oxazolo[5,4-b]pyridine |
| InChIKey | POIIXVAOLCUFPN-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=N2)C3=CC4=CC=CC=C4C=C3)C(F)(F)F |
Computed by PubChem (NCBI)