CAS 853658-14-7 is the registry number for cis-3,6-Endomethylene tetrahydrophthalic anhydride. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg, 5000mg.
(1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione (CAS 853658-14-7) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione. InChIKey: LQOPXMZSGSTGMF-UMRXKNAASA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| InChIKey | LQOPXMZSGSTGMF-UMRXKNAASA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H]3[C@H]2C(=O)OC3=O |
Computed by PubChem (NCBI)