CAS 853689-23-3 is the registry number for N-(4-(2-((5,7-Dichloro-2-methylquinolin-8-yl)oxy)acetyl)phenyl)acetamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
N-[4-[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]phenyl]acetamide (CAS 853689-23-3) is a chemical compound with the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.3 g/mol. IUPAC name: N-[4-[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]phenyl]acetamide. InChIKey: NEFQXILKFYXGSS-UHFFFAOYSA-N.
| Molecular formula | C20H16Cl2N2O3 |
|---|---|
| Molecular weight | 403.3 g/mol |
| IUPAC name | N-[4-[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]phenyl]acetamide |
| InChIKey | NEFQXILKFYXGSS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2OCC(=O)C3=CC=C(C=C3)NC(=O)C)Cl)Cl |
Computed by PubChem (NCBI)