CAS 853694-04-9 is the registry number for N-(5-((4-Fluoro-2-methylphenyl)carbamoyl)-2-methylphenyl)furan-2-carboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 100mg, 250mg, 1g.
N-[5-[(4-fluoro-2-methylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide (CAS 853694-04-9) is a chemical compound with the molecular formula C20H17FN2O3 and a molecular weight of 352.4 g/mol. IUPAC name: N-[5-[(4-fluoro-2-methylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide. InChIKey: QFGOIVAGAURAEJ-UHFFFAOYSA-N.
| Molecular formula | C20H17FN2O3 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | N-[5-[(4-fluoro-2-methylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide |
| InChIKey | QFGOIVAGAURAEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=C(C=C(C=C2)F)C)NC(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)