CAS 853695-44-0 is the registry number for 2-((3-Chloro-4-fluorophenyl)amino)-N-(4-(piperidin-1-ylsulfonyl)phenyl)acetamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 10mg, 50mg, 100mg.
2-(3-chloro-4-fluoroanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide (CAS 853695-44-0) is a chemical compound with the molecular formula C19H21ClFN3O3S and a molecular weight of 425.9 g/mol. IUPAC name: 2-(3-chloro-4-fluoroanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide. InChIKey: VXFKIHSAOLPRJD-UHFFFAOYSA-N.
| Molecular formula | C19H21ClFN3O3S |
|---|---|
| Molecular weight | 425.9 g/mol |
| IUPAC name | 2-(3-chloro-4-fluoroanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| InChIKey | VXFKIHSAOLPRJD-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)CNC3=CC(=C(C=C3)F)Cl |
Computed by PubChem (NCBI)