CAS 853784-24-4 is the registry number for 2-(Trifluoromethyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine (CAS 853784-24-4) is a chemical compound with the molecular formula C7H7F3N2S and a molecular weight of 208.21 g/mol. IUPAC name: 2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine. InChIKey: XGUALGYMAJUNLG-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 2-(trifluoromethyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
| InChIKey | XGUALGYMAJUNLG-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N=C(S2)C(F)(F)F |
Computed by PubChem (NCBI)