CAS 85386-85-2 appears in our catalog under these names: 1-(3-Bromopyridin-2-yl)piperazine hydrochloride, 97%, 1-(3-Bromopyridin-2-yl)piperazine hydrochloride, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g, 100mg.
1-(3-bromo-2-pyridinyl)piperazine;hydrochloride (CAS 85386-85-2) is a chemical compound with the molecular formula C9H13BrClN3 and a molecular weight of 278.58 g/mol. IUPAC name: 1-(3-bromo-2-pyridinyl)piperazine;hydrochloride. InChIKey: SSQFKKFRVCWWSR-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClN3 |
|---|---|
| Molecular weight | 278.58 g/mol |
| IUPAC name | 1-(3-bromo-2-pyridinyl)piperazine;hydrochloride |
| InChIKey | SSQFKKFRVCWWSR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC=N2)Br.Cl |
Computed by PubChem (NCBI)