CAS 85390-98-3 appears in our catalog under these names: 5'-Phenyl-[1,1':3',1''-terphenyl]-2'-carbaldehyde, 95%, 5'-Phenyl-[1,1':3',1''-terphenyl]-2'-carbaldehyde, ≥95%, ≥95%, 5'-PHENYL-[1,1':3',1''-TERPHENYL]-2'-CARBALDEHYDE, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2,4,6-triphenylbenzaldehyde (CAS 85390-98-3) is a chemical compound with the molecular formula C25H18O and a molecular weight of 334.4 g/mol. IUPAC name: 2,4,6-triphenylbenzaldehyde. InChIKey: IQCJKKFSTPHNEX-UHFFFAOYSA-N.
| Molecular formula | C25H18O |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2,4,6-triphenylbenzaldehyde |
| InChIKey | IQCJKKFSTPHNEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)C3=CC=CC=C3)C=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)