CAS 853950-79-5 is the registry number for (S)-2-(((3-Methyl-4-nitropyridin-2-yl)methyl)sulfinyl)-1h-benzo[d]imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(S)-(3-methyl-4-nitro-2-pyridinyl)methylsulfinyl]-1H-benzimidazole (CAS 853950-79-5) is a chemical compound with the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. IUPAC name: 2-[(S)-(3-methyl-4-nitro-2-pyridinyl)methylsulfinyl]-1H-benzimidazole. InChIKey: PSPWSLJRXBXEMQ-QFIPXVFZSA-N.
| Molecular formula | C14H12N4O3S |
|---|---|
| Molecular weight | 316.34 g/mol |
| IUPAC name | 2-[(S)-(3-methyl-4-nitro-2-pyridinyl)methylsulfinyl]-1H-benzimidazole |
| InChIKey | PSPWSLJRXBXEMQ-QFIPXVFZSA-N |
| SMILES | CC1=C(C=CN=C1C[S@](=O)C2=NC3=CC=CC=C3N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)