Products 854039-48-8

CAS 854039-48-8 is the registry number for WAY-323496-10mMinDMSO,,, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-ethyl-N-(2-phenoxyphenyl)benzotriazole-5-carboxamide (CAS 854039-48-8) is a chemical compound with the molecular formula C21H18N4O2 and a molecular weight of 358.4 g/mol. IUPAC name: 1-ethyl-N-(2-phenoxyphenyl)benzotriazole-5-carboxamide. InChIKey: GNMGDRAGUHDBSL-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18N4O2
Molecular weight358.4 g/mol
IUPAC name1-ethyl-N-(2-phenoxyphenyl)benzotriazole-5-carboxamide
InChIKeyGNMGDRAGUHDBSL-UHFFFAOYSA-N
SMILESCCN1C2=C(C=C(C=C2)C(=O)NC3=CC=CC=C3OC4=CC=CC=C4)N=N1

Computed by PubChem (NCBI)