CAS 854127-90-5 appears in our catalog under these names: LY303511 (hydrochloride), 2-(4-Piperazinyl)-8-phenyl-4H-1-benzopyran-4-one dihydrochloride, LY 303511 (dihydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, Get quote.
8-phenyl-2-piperazin-1-ylchromen-4-one;dihydrochloride (CAS 854127-90-5) is a chemical compound with the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.3 g/mol. IUPAC name: 8-phenyl-2-piperazin-1-ylchromen-4-one;dihydrochloride. InChIKey: GUISTZFSXPSDQO-UHFFFAOYSA-N.
| Molecular formula | C19H20Cl2N2O2 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 8-phenyl-2-piperazin-1-ylchromen-4-one;dihydrochloride |
| InChIKey | GUISTZFSXPSDQO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=O)C3=C(O2)C(=CC=C3)C4=CC=CC=C4.Cl.Cl |
Computed by PubChem (NCBI)