CAS 854234-91-6 appears in our catalog under these names: 1,1'-Biphenyl, 3-chloro-3'-iodo-, 95%, 3–chloro–3'–iodo–1,1'–biphenyl, 1,1'-Biphenyl, 3-chloro-3'-iodo-, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg.
1-chloro-3-(3-iodophenyl)benzene (CAS 854234-91-6) is a chemical compound with the molecular formula C12H8ClI and a molecular weight of 314.55 g/mol. IUPAC name: 1-chloro-3-(3-iodophenyl)benzene. InChIKey: LEAYQFHHIWUKOM-UHFFFAOYSA-N.
| Molecular formula | C12H8ClI |
|---|---|
| Molecular weight | 314.55 g/mol |
| IUPAC name | 1-chloro-3-(3-iodophenyl)benzene |
| InChIKey | LEAYQFHHIWUKOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)