CAS 854357-40-7 appears in our catalog under these names: Ethyl 3-(bromomethyl)-4-fluoro-1-benzothiophene-2-carboxylate, 95%, Ethyl 3-(bromomethyl)-4-fluoro-1-benzothiophene-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
Ethyl 3-(bromomethyl)-4-fluoro-1-benzothiophene-2-carboxylate (CAS 854357-40-7) is a chemical compound with the molecular formula C12H10BrFO2S and a molecular weight of 317.18 g/mol. IUPAC name: ethyl 3-(bromomethyl)-4-fluoro-1-benzothiophene-2-carboxylate. InChIKey: VLWGPIATBMFMEW-UHFFFAOYSA-N.
| Molecular formula | C12H10BrFO2S |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | ethyl 3-(bromomethyl)-4-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | VLWGPIATBMFMEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC=C2S1)F)CBr |
Computed by PubChem (NCBI)