Products 85443-48-7
CAS 85443-48-7 appears in our catalog under these names: Bencianol (ZY15051), Bencianol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, 25mg, 50mg, Get quote.
(2R,3S)-2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromene-3,5,7-triol (CAS 85443-48-7) is a chemical compound with the molecular formula C28H22O6 and a molecular weight of 454.5 g/mol. IUPAC name: (2R,3S)-2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromene-3,5,7-triol. InChIKey: NGJOOUAZHCZCOW-WNCULLNHSA-N.
| Molecular formula | C28H22O6 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | (2R,3S)-2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChIKey | NGJOOUAZHCZCOW-WNCULLNHSA-N |
| SMILES | C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC4=C(C=C3)OC(O4)(C5=CC=CC=C5)C6=CC=CC=C6)O |
Computed by PubChem (NCBI)