Products 854431-59-7

CAS 854431-59-7 is the registry number for Methyl 2-bromo-3-methoxy-3-methylbutanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-3-methoxy-3-methylbutanoate (CAS 854431-59-7) is a chemical compound with the molecular formula C7H13BrO3 and a molecular weight of 225.08 g/mol. IUPAC name: methyl 2-bromo-3-methoxy-3-methylbutanoate. InChIKey: QIUYHXYZDBIUDY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13BrO3
Molecular weight225.08 g/mol
IUPAC namemethyl 2-bromo-3-methoxy-3-methylbutanoate
InChIKeyQIUYHXYZDBIUDY-UHFFFAOYSA-N
SMILESCC(C)(C(C(=O)OC)Br)OC

Computed by PubChem (NCBI)