CAS 85454-69-9 is the registry number for 3-Cyclohexanepropionic Sodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2-cyclohexylpropanoate (CAS 85454-69-9) is a chemical compound with the molecular formula C9H15NaO2 and a molecular weight of 178.20 g/mol. IUPAC name: sodium 2-cyclohexylpropanoate. InChIKey: ANDYHHNVRJLUGG-UHFFFAOYSA-M.
| Molecular formula | C9H15NaO2 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | sodium 2-cyclohexylpropanoate |
| InChIKey | ANDYHHNVRJLUGG-UHFFFAOYSA-M |
| SMILES | CC(C1CCCCC1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)