Products 854863-97-1
CAS 854863-97-1 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)quinoline-4-carbonyl chloride, 95%, 2-(3,4-Dichlorophenyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(3,4-dichlorophenyl)quinoline-4-carbonyl chloride (CAS 854863-97-1) is a chemical compound with the molecular formula C16H8Cl3NO and a molecular weight of 336.6 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)quinoline-4-carbonyl chloride. InChIKey: AAOPZLLXXZINKG-UHFFFAOYSA-N.
| Molecular formula | C16H8Cl3NO |
|---|---|
| Molecular weight | 336.6 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)quinoline-4-carbonyl chloride |
| InChIKey | AAOPZLLXXZINKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC(=C(C=C3)Cl)Cl)C(=O)Cl |
Computed by PubChem (NCBI)