Products 854874-29-6

CAS 854874-29-6 is the registry number for 2-(2,4-Dichlorophenoxy)butanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,4-dichlorophenoxy)butanoyl chloride (CAS 854874-29-6) is a chemical compound with the molecular formula C10H9Cl3O2 and a molecular weight of 267.5 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)butanoyl chloride. InChIKey: KOTKSYLMUZDZPX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9Cl3O2
Molecular weight267.5 g/mol
IUPAC name2-(2,4-dichlorophenoxy)butanoyl chloride
InChIKeyKOTKSYLMUZDZPX-UHFFFAOYSA-N
SMILESCCC(C(=O)Cl)OC1=C(C=C(C=C1)Cl)Cl

Computed by PubChem (NCBI)