Products 854874-29-6
CAS 854874-29-6 is the registry number for 2-(2,4-Dichlorophenoxy)butanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,4-dichlorophenoxy)butanoyl chloride (CAS 854874-29-6) is a chemical compound with the molecular formula C10H9Cl3O2 and a molecular weight of 267.5 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)butanoyl chloride. InChIKey: KOTKSYLMUZDZPX-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl3O2 |
|---|---|
| Molecular weight | 267.5 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)butanoyl chloride |
| InChIKey | KOTKSYLMUZDZPX-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)Cl)OC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)