CAS 854890-84-9 is the registry number for 1-(2,5-Dibromophenyl)thiourea, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(2,5-dibromophenyl)thiourea (CAS 854890-84-9) is a chemical compound with the molecular formula C7H6Br2N2S and a molecular weight of 310.01 g/mol. IUPAC name: (2,5-dibromophenyl)thiourea. InChIKey: GDVJWWGNIMWFRJ-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2S |
|---|---|
| Molecular weight | 310.01 g/mol |
| IUPAC name | (2,5-dibromophenyl)thiourea |
| InChIKey | GDVJWWGNIMWFRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)NC(=S)N)Br |
Computed by PubChem (NCBI)