Products 854937-41-0
CAS 854937-41-0 is the registry number for (1S,5S)-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1S,5S)-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene (CAS 854937-41-0) is a chemical compound with the molecular formula C21H20 and a molecular weight of 272.4 g/mol. IUPAC name: (1S,5S)-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene. InChIKey: LCCWHYICAHCEHC-OALUTQOASA-N.
| Molecular formula | C21H20 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (1S,5S)-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene |
| InChIKey | LCCWHYICAHCEHC-OALUTQOASA-N |
| SMILES | C1C=C([C@H]2CC=C([C@@H]1C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)