Products 85505-64-2
CAS 85505-64-2 is the registry number for Vapiprost. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(Z)-7-[(1R,2R,3S,5S)-3-hydroxy-5-[(4-phenylphenyl)methoxy]-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid (CAS 85505-64-2) is a chemical compound with the molecular formula C30H39NO4 and a molecular weight of 477.6 g/mol. IUPAC name: (Z)-7-[(1R,2R,3S,5S)-3-hydroxy-5-[(4-phenylphenyl)methoxy]-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid. InChIKey: GQGRDYWMOPRROR-XUSMOFMBSA-N.
| Molecular formula | C30H39NO4 |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3S,5S)-3-hydroxy-5-[(4-phenylphenyl)methoxy]-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
| InChIKey | GQGRDYWMOPRROR-XUSMOFMBSA-N |
| SMILES | C1CCN(CC1)[C@H]2[C@H](C[C@@H]([C@@H]2CC/C=C\CCC(=O)O)OCC3=CC=C(C=C3)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)