CAS 855350-44-6 is the registry number for 4-(2-Aminopropyl)-2-methyl-phenol Hydrobromide. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
4-(2-aminopropyl)-2-methylphenol;hydrobromide (CAS 855350-44-6) is a chemical compound with the molecular formula C10H16BrNO and a molecular weight of 246.14 g/mol. IUPAC name: 4-(2-aminopropyl)-2-methylphenol;hydrobromide. InChIKey: VNSDZLBERUYPJR-UHFFFAOYSA-N.
| Molecular formula | C10H16BrNO |
|---|---|
| Molecular weight | 246.14 g/mol |
| IUPAC name | 4-(2-aminopropyl)-2-methylphenol;hydrobromide |
| InChIKey | VNSDZLBERUYPJR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC(C)N)O.Br |
Computed by PubChem (NCBI)