CAS 85549-51-5 appears in our catalog under these names: Methyl (Methyl 3-Deoxy-D-arabino-heptulopyranosid)uronate, Methyl (methyl 3-deoxy-D-arabino-hept-2-ulopyranosid)onate. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 2mg.
Methyl (2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxane-2-carboxylate (CAS 85549-51-5) is a chemical compound with the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. IUPAC name: methyl (2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxane-2-carboxylate. InChIKey: PUXQJBPBWGJAMX-JAGXHNFQSA-N.
| Molecular formula | C9H16O7 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | methyl (2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxane-2-carboxylate |
| InChIKey | PUXQJBPBWGJAMX-JAGXHNFQSA-N |
| SMILES | COC(=O)[C@]1(C[C@H]([C@@H]([C@H](O1)CO)O)O)OC |
Computed by PubChem (NCBI)