CAS 855616-04-5 is the registry number for 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetrabenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[1,2,2-tris(4-carbamimidoylphenyl)ethenyl]benzenecarboximidamide (CAS 855616-04-5) is a chemical compound with the molecular formula C30H28N8 and a molecular weight of 500.6 g/mol. IUPAC name: 4-[1,2,2-tris(4-carbamimidoylphenyl)ethenyl]benzenecarboximidamide. InChIKey: XDDLECGZOBFBEJ-UHFFFAOYSA-N.
| Molecular formula | C30H28N8 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 4-[1,2,2-tris(4-carbamimidoylphenyl)ethenyl]benzenecarboximidamide |
| InChIKey | XDDLECGZOBFBEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=C(C2=CC=C(C=C2)C(=N)N)C3=CC=C(C=C3)C(=N)N)C4=CC=C(C=C4)C(=N)N)C(=N)N |
Computed by PubChem (NCBI)