Products 855749-53-0
CAS 855749-53-0 is the registry number for 2-Bromo-4-hydroxy-5-nitrobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-hydroxy-5-nitrobenzoic acid (CAS 855749-53-0) is a chemical compound with the molecular formula C7H4BrNO5 and a molecular weight of 262.01 g/mol. IUPAC name: 2-bromo-4-hydroxy-5-nitrobenzoic acid. InChIKey: MWYWMDZVAMQANL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO5 |
|---|---|
| Molecular weight | 262.01 g/mol |
| IUPAC name | 2-bromo-4-hydroxy-5-nitrobenzoic acid |
| InChIKey | MWYWMDZVAMQANL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])O)Br)C(=O)O |
Computed by PubChem (NCBI)