CAS 855751-76-7 is the registry number for 3-Chloro-2-(phenylmethoxy)-1,1′-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-chloro-3-phenyl-2-phenylmethoxybenzene (CAS 855751-76-7) is a chemical compound with the molecular formula C19H15ClO and a molecular weight of 294.8 g/mol. IUPAC name: 1-chloro-3-phenyl-2-phenylmethoxybenzene. InChIKey: UVEFAPCJDAGMSE-UHFFFAOYSA-N.
| Molecular formula | C19H15ClO |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | 1-chloro-3-phenyl-2-phenylmethoxybenzene |
| InChIKey | UVEFAPCJDAGMSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)