CAS 855837-85-3 appears in our catalog under these names: Quinoline-2,6-diamine, 95%, Quinoline-2,6-diamine, 95+%, quinoline-2,6-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 5g, 1g, 50mg, 0,5g.
Quinoline-2,6-diamine (CAS 855837-85-3) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: quinoline-2,6-diamine. InChIKey: WECFWBJFIOOXPR-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | quinoline-2,6-diamine |
| InChIKey | WECFWBJFIOOXPR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C=C1N |
Computed by PubChem (NCBI)