Products 855951-34-7

CAS 855951-34-7 is the registry number for Ethyl(3-methoxybenzyl)sulfane 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(ethylsulfanylmethyl)-3-methoxybenzene (CAS 855951-34-7) is a chemical compound with the molecular formula C10H14OS and a molecular weight of 182.28 g/mol. IUPAC name: 1-(ethylsulfanylmethyl)-3-methoxybenzene. InChIKey: STVMCBHRQKYARJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14OS
Molecular weight182.28 g/mol
IUPAC name1-(ethylsulfanylmethyl)-3-methoxybenzene
InChIKeySTVMCBHRQKYARJ-UHFFFAOYSA-N
SMILESCCSCC1=CC(=CC=C1)OC

Computed by PubChem (NCBI)