Products 855997-06-7

CAS 855997-06-7 is the registry number for Gatifloxacin Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxo-1H-quinoline-3-carboxylic acid (CAS 855997-06-7) is a chemical compound with the molecular formula C16H18FN3O4 and a molecular weight of 335.33 g/mol. IUPAC name: 6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: AJUURTRETAMJJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18FN3O4
Molecular weight335.33 g/mol
IUPAC name6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxo-1H-quinoline-3-carboxylic acid
InChIKeyAJUURTRETAMJJJ-UHFFFAOYSA-N
SMILESCC1CN(CCN1)C2=C(C=C3C(=C2OC)NC=C(C3=O)C(=O)O)F

Computed by PubChem (NCBI)