CAS 856083-17-5 is the registry number for 8-Iodoquinolin-5-ol, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
8-iodoquinolin-5-ol (CAS 856083-17-5) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 8-iodoquinolin-5-ol. InChIKey: ZNYIGIDYHDFZNU-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 8-iodoquinolin-5-ol |
| InChIKey | ZNYIGIDYHDFZNU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)I)O |
Computed by PubChem (NCBI)