Products 856106-63-3

CAS 856106-63-3 appears in our catalog under these names: 2,4-dihydroxy-5-iodobenzoic acid, 95%, 2,4-dihydroxy-5-iodobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

2,4-dihydroxy-5-iodobenzoic acid (CAS 856106-63-3) is a chemical compound with the molecular formula C7H5IO4 and a molecular weight of 280.02 g/mol. IUPAC name: 2,4-dihydroxy-5-iodobenzoic acid. InChIKey: KIHIUNVBVKLJAL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5IO4
Molecular weight280.02 g/mol
IUPAC name2,4-dihydroxy-5-iodobenzoic acid
InChIKeyKIHIUNVBVKLJAL-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1I)O)O)C(=O)O

Computed by PubChem (NCBI)