CAS 85612-60-8 appears in our catalog under these names: (2S)-3-Phenyl-1,2-propanediamine, (2S)-3-phenyl-1,2-propanediamine, 95%. Offered by: TRC, AmBeed. Available pack sizes: 250mg, 500mg, 1g.
(2S)-3-phenylpropane-1,2-diamine (CAS 85612-60-8) is a chemical compound with the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. IUPAC name: (2S)-3-phenylpropane-1,2-diamine. InChIKey: CXFFQOZYXJHZNJ-VIFPVBQESA-N.
| Molecular formula | C9H14N2 |
|---|---|
| Molecular weight | 150.22 g/mol |
| IUPAC name | (2S)-3-phenylpropane-1,2-diamine |
| InChIKey | CXFFQOZYXJHZNJ-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CN)N |
Computed by PubChem (NCBI)