Products 856167-47-0
CAS 856167-47-0 appears in our catalog under these names: 3–Iodo–4–isopropoxybenzoic acid, 3-Iodo-4-isopropoxybenzoic acid, 98%, 98%, 3-Iodo-4-isopropoxybenzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-iodo-4-propan-2-yloxybenzoic acid (CAS 856167-47-0) is a chemical compound with the molecular formula C10H11IO3 and a molecular weight of 306.10 g/mol. IUPAC name: 3-iodo-4-propan-2-yloxybenzoic acid. InChIKey: HHYAIENIWGJTJX-UHFFFAOYSA-N.
| Molecular formula | C10H11IO3 |
|---|---|
| Molecular weight | 306.10 g/mol |
| IUPAC name | 3-iodo-4-propan-2-yloxybenzoic acid |
| InChIKey | HHYAIENIWGJTJX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C(=O)O)I |
Computed by PubChem (NCBI)