CAS 856177-01-0 appears in our catalog under these names: 2,6-Dihydroxy-4-methylbenzoic acid potassium salt, 95%, 2,6-Dihydroxy-4-methylbenzoic acid potassium salt, 98%, 2,6-Dihydroxy-4-methylbenzoic acid potassium, 2,6-Dihydroxy-4-methylbenzoic acid potas, sium, 25 g, 2,6-Dihydroxy-4-methylbenzoic acid potas, sium, 50 g. Offered by: Combi-blocks, AmBeed, Biosynth, Roth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g.
Potassium 2,6-dihydroxy-4-methylbenzoate (CAS 856177-01-0) is a chemical compound with the molecular formula C8H7KO4 and a molecular weight of 206.24 g/mol. IUPAC name: potassium 2,6-dihydroxy-4-methylbenzoate. InChIKey: XWJWWUCRBWRHHW-UHFFFAOYSA-M.
| Molecular formula | C8H7KO4 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | potassium 2,6-dihydroxy-4-methylbenzoate |
| InChIKey | XWJWWUCRBWRHHW-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)O)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)