CAS 85618-19-5 appears in our catalog under these names: (2S,3R,4S,5S,6R)-2-(Hexylthio)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol, 95+%, Hexyl b-D-Thioglucopyranoside, >95% (HPLC), Hexyl beta-D-Thioglucopyranoside, >95% (HPLC), Hexyl b-D-thioglucopyranoside, Hexyl 1-thio-β-D-glucopyranoside. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 1g, 500mg, 1000mg, 2000mg, 5000mg, 10000mg.
(2S,3R,4S,5S,6R)-2-hexylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 85618-19-5) is a chemical compound with the molecular formula C12H24O5S and a molecular weight of 280.38 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-hexylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: ATFNYTMEOCLMPS-ZIQFBCGOSA-N.
| Molecular formula | C12H24O5S |
|---|---|
| Molecular weight | 280.38 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-hexylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | ATFNYTMEOCLMPS-ZIQFBCGOSA-N |
| SMILES | CCCCCCS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)