CAS 856197-47-2 is the registry number for 2-Bromo-5-iodo-1,3-diisopropylbenzene, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 1g, 250mg, 100mg.
2-bromo-5-iodo-1,3-di(propan-2-yl)benzene (CAS 856197-47-2) is a chemical compound with the molecular formula C12H16BrI and a molecular weight of 367.06 g/mol. IUPAC name: 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene. InChIKey: IVELKHGZTBWGNN-UHFFFAOYSA-N.
| Molecular formula | C12H16BrI |
|---|---|
| Molecular weight | 367.06 g/mol |
| IUPAC name | 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene |
| InChIKey | IVELKHGZTBWGNN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1Br)C(C)C)I |
Computed by PubChem (NCBI)