CAS 85622-95-3 is the registry number for Mitozolomide, 90.000000%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
3-(2-chloroethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (CAS 85622-95-3) is a chemical compound with the molecular formula C7H7ClN6O2 and a molecular weight of 242.62 g/mol. IUPAC name: 3-(2-chloroethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide. InChIKey: QXYYYPFGTSJXNS-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN6O2 |
|---|---|
| Molecular weight | 242.62 g/mol |
| IUPAC name | 3-(2-chloroethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| InChIKey | QXYYYPFGTSJXNS-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2N1C(=O)N(N=N2)CCCl)C(=O)N |
Computed by PubChem (NCBI)