CAS 856307-27-2 appears in our catalog under these names: Metamizole EP Impurity C HCl, 4-Methylaminoantipyrine Hydrochloride, >95% (HPLC), 4-(Methylamino)antipyrine hydrochloride, Metamizole EP Impurity C (as Hydrochloride), 4-Methylamino antipyrine hydrochloride. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Mikromol, TargetMol. Available pack sizes: on request, 2,5mg, 25mg, 100mg, 1mg, 50mg, 0,05g, 0,1g.
1,5-dimethyl-4-(methylamino)-2-phenylpyrazol-3-one;hydrochloride (CAS 856307-27-2) is a chemical compound with the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. IUPAC name: 1,5-dimethyl-4-(methylamino)-2-phenylpyrazol-3-one;hydrochloride. InChIKey: NNONRTWOIVTAHL-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O |
|---|---|
| Molecular weight | 253.73 g/mol |
| IUPAC name | 1,5-dimethyl-4-(methylamino)-2-phenylpyrazol-3-one;hydrochloride |
| InChIKey | NNONRTWOIVTAHL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC.Cl |
Computed by PubChem (NCBI)