CAS 85634-76-0 appears in our catalog under these names: (4-Bromo-2,6-dichlorophenyl)hydrazine, 95%, (4-Bromo-2,6-dichlorophenyl)hydrazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(4-bromo-2,6-dichlorophenyl)hydrazine (CAS 85634-76-0) is a chemical compound with the molecular formula C6H5BrCl2N2 and a molecular weight of 255.92 g/mol. IUPAC name: (4-bromo-2,6-dichlorophenyl)hydrazine. InChIKey: GIAXDNCWHOZYFO-UHFFFAOYSA-N.
| Molecular formula | C6H5BrCl2N2 |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | (4-bromo-2,6-dichlorophenyl)hydrazine |
| InChIKey | GIAXDNCWHOZYFO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)NN)Cl)Br |
Computed by PubChem (NCBI)