CAS 85643-19-2 appears in our catalog under these names: Curculigoside, 95%, Curculigoside, Curculigoside, 98%, Curculigoside/ 99.85% (existing batch purity), Curculigoside A, >98.0%(HPLC). Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, GLPBio. Available pack sizes: 10mg, 50mg, on request, 5mg, 20mg, 1mg, 25mg, 100mg.
[5-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 2,6-dimethoxybenzoate (CAS 85643-19-2) is a chemical compound with the molecular formula C22H26O11 and a molecular weight of 466.4 g/mol. IUPAC name: [5-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 2,6-dimethoxybenzoate. InChIKey: SJJRKHVKAXVFJQ-QKYBYQKWSA-N.
| Molecular formula | C22H26O11 |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | [5-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 2,6-dimethoxybenzoate |
| InChIKey | SJJRKHVKAXVFJQ-QKYBYQKWSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C(=O)OCC2=C(C=CC(=C2)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)