Products 856436-16-3
CAS 856436-16-3 appears in our catalog under these names: 3-((1H-Pyrrol-2-yl)methylene)-5-(pyridin-3-yl)indolin-2-one methanesulfonate, 97%, JI6/ 97.74% (existing batch purity), JAK3 Inhibitor VI 1PC X 5MG, JI6, JI6, 97%. Offered by: BLDpharm, TargetMol, Sigma-Aldrich, MedChemExpress, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1mg, 5mg, 500mg, 1 mg.
Methanesulfonic acid;(3Z)-5-pyridin-3-yl-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one (CAS 856436-16-3) is a chemical compound with the molecular formula C19H17N3O4S and a molecular weight of 383.4 g/mol. IUPAC name: methanesulfonic acid;(3Z)-5-pyridin-3-yl-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one. InChIKey: ZUDPNBZMAJGYTE-HYMQDMCPSA-N.
| Molecular formula | C19H17N3O4S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | methanesulfonic acid;(3Z)-5-pyridin-3-yl-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
| InChIKey | ZUDPNBZMAJGYTE-HYMQDMCPSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CN=C1)C2=CC\3=C(C=C2)NC(=O)/C3=C\C4=CC=CN4 |
Computed by PubChem (NCBI)