Products 856632-37-6

CAS 856632-37-6 appears in our catalog under these names: 3'-methyl-(2,2'-bioxirane)-3-carboxylic acid, Levocarnitine Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-methyloxiran-2-yl)oxirane-2-carboxylic acid (CAS 856632-37-6) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: 3-(3-methyloxiran-2-yl)oxirane-2-carboxylic acid. InChIKey: WYSWXNFLDCVEDT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8O4
Molecular weight144.12 g/mol
IUPAC name3-(3-methyloxiran-2-yl)oxirane-2-carboxylic acid
InChIKeyWYSWXNFLDCVEDT-UHFFFAOYSA-N
SMILESCC1C(O1)C2C(O2)C(=O)O

Computed by PubChem (NCBI)