Products 856758-61-7
CAS 856758-61-7 is the registry number for (1R)-1-(4-Bromophenyl)propan-1-amine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(1R)-1-(4-bromophenyl)propan-1-amine (CAS 856758-61-7) is a chemical compound with the molecular formula C9H12BrN and a molecular weight of 214.10 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)propan-1-amine. InChIKey: WKPWFAZJGVXPCH-SECBINFHSA-N.
| Molecular formula | C9H12BrN |
|---|---|
| Molecular weight | 214.10 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)propan-1-amine |
| InChIKey | WKPWFAZJGVXPCH-SECBINFHSA-N |
| SMILES | CC[C@H](C1=CC=C(C=C1)Br)N |
Computed by PubChem (NCBI)