CAS 85678-80-4 is the registry number for 5H-Benzo[4,5]thiazolo[3,2-a]pyrido[3,2-e]pyrimidin-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
11-thia-1,3,9-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,9,12,14,16-heptaen-8-one (CAS 85678-80-4) is a chemical compound with the molecular formula C13H7N3OS and a molecular weight of 253.28 g/mol. IUPAC name: 11-thia-1,3,9-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,9,12,14,16-heptaen-8-one. InChIKey: MXESMWXWOKCZLG-UHFFFAOYSA-N.
| Molecular formula | C13H7N3OS |
|---|---|
| Molecular weight | 253.28 g/mol |
| IUPAC name | 11-thia-1,3,9-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,9,12,14,16-heptaen-8-one |
| InChIKey | MXESMWXWOKCZLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N3C4=C(C=CC=N4)C(=O)N=C3S2 |
Computed by PubChem (NCBI)